About 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one
6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one (PubChem CID 10926687) has the molecular formula C13H13Cl3N2O2S
and a molecular weight of 367.69 g/mol. Its IUPAC name is 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 10926687 |
| Molecular Formula | C13H13Cl3N2O2S |
| Molecular Weight | 367.69 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCn1c(OCC2CC2(Cl)Cl)nc2sc(Cl)cc2c1=O |
| InChI | InChI=1S/C13H13Cl3N2O2S/c1-2-3-18-11(19)8-4-9(14)21-10(8)17-12(18)20-6-7-5-13(7,15)16/h4,7H,2-3,5-6H2,1H3 |
| InChIKey | PLIKSHCPSMYIMX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.69 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one (CID 10926687) is 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one is CCCn1c(OCC2CC2(Cl)Cl)nc2sc(Cl)cc2c1=O.
What is the InChIKey of 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one?
The InChIKey is PLIKSHCPSMYIMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl3N2O2S/c1-2-3-18-11(19)8-4-9(14)21-10(8)17-12(18)20-6-7-5-13(7,15)16/h4,7H,2-3,5-6H2,1H3.
What are the key properties of 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one?
6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one has a molecular weight of 367.69 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 10926687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).