C20H17ClN2O3 — CID 10926721
3-[[3-[2-(4-chloro-3-methylphenyl)-2-oxoethoxy]phenyl]methyl]-1H-pyridazin-6-one (PubChem CID 10926721) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is 3-[[3-[2-(4-chloro-3-methylphenyl)-2-oxoethoxy]phenyl]methyl]-1H-pyridazin-6-one.
| Compound Name | 3-[[3-[2-(4-chloro-3-methylphenyl)-2-oxoethoxy]phenyl]methyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 10926721 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3-[[3-[2-(4-chloro-3-methylphenyl)-2-oxoethoxy]phenyl]methyl]-1H-pyridazin-6-one |
| SMILES | Cc1cc(C(=O)COc2cccc(Cc3ccc(=O)[nH]n3)c2)ccc1Cl |
| InChI | InChI=1S/C20H17ClN2O3/c1-13-9-15(5-7-18(13)21)19(24)12-26-17-4-2-3-14(11-17)10-16-6-8-20(25)23-22-16/h2-9,11H,10,12H2,1H3,(H,23,25) |
| InChIKey | DULAPBFZDZBIFZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |