C19H16Cl2N4O — CID 109267626
2-(2,4-dichloroanilino)-N-ethyl-N-phenylpyrimidine-5-carboxamide (PubChem CID 109267626) has the molecular formula C19H16Cl2N4O and a molecular weight of 387.27 g/mol. Its IUPAC name is 2-(2,4-dichloroanilino)-N-ethyl-N-phenylpyrimidine-5-carboxamide.
| Compound Name | 2-(2,4-dichloroanilino)-N-ethyl-N-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109267626 |
| Molecular Formula | C19H16Cl2N4O |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-(2,4-dichloroanilino)-N-ethyl-N-phenylpyrimidine-5-carboxamide |
| SMILES | CCN(C(=O)c1cnc(Nc2ccc(Cl)cc2Cl)nc1)c1ccccc1 |
| InChI | InChI=1S/C19H16Cl2N4O/c1-2-25(15-6-4-3-5-7-15)18(26)13-11-22-19(23-12-13)24-17-9-8-14(20)10-16(17)21/h3-12H,2H2,1H3,(H,22,23,24) |
| InChIKey | LTHGKQRGFCVEND-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |