C21H20F2N4O — CID 109268225
N-(2-tert-butylphenyl)-2-(3,4-difluoroanilino)pyrimidine-5-carboxamide (PubChem CID 109268225) has the molecular formula C21H20F2N4O and a molecular weight of 382.41 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-2-(3,4-difluoroanilino)pyrimidine-5-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-2-(3,4-difluoroanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109268225 |
| Molecular Formula | C21H20F2N4O |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-(2-tert-butylphenyl)-2-(3,4-difluoroanilino)pyrimidine-5-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)c1cnc(Nc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C21H20F2N4O/c1-21(2,3)15-6-4-5-7-18(15)27-19(28)13-11-24-20(25-12-13)26-14-8-9-16(22)17(23)10-14/h4-12H,1-3H3,(H,27,28)(H,24,25,26) |
| InChIKey | VZZCCJFOPTTZAH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |