About 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene
6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene (PubChem CID 10926955) has the molecular formula C24H26O4
and a molecular weight of 378.47 g/mol. Its IUPAC name is 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene.
Molecular Properties
| Compound Name | 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene |
| PubChem CID | 10926955 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene |
| SMILES | COc1cc2c(c(-c3cc(OC)cc4c3OC(C)(C)C=C4)c1)OC(C)(C)C=C2 |
| InChI | InChI=1S/C24H26O4/c1-23(2)9-7-15-11-17(25-5)13-19(21(15)27-23)20-14-18(26-6)12-16-8-10-24(3,4)28-22(16)20/h7-14H,1-6H3 |
| InChIKey | GEXYILDOMGMFQN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene?
The IUPAC name of 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene (CID 10926955) is 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene.
What is the SMILES notation for 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene?
The canonical SMILES for 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene is COc1cc2c(c(-c3cc(OC)cc4c3OC(C)(C)C=C4)c1)OC(C)(C)C=C2.
What is the InChIKey of 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene?
The InChIKey is GEXYILDOMGMFQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O4/c1-23(2)9-7-15-11-17(25-5)13-19(21(15)27-23)20-14-18(26-6)12-16-8-10-24(3,4)28-22(16)20/h7-14H,1-6H3.
What are the key properties of 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene?
6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene has a molecular weight of 378.47 g/mol, XLogP of 5.74, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-8-(6-methoxy-2,2-dimethylchromen-8-yl)-2,2-dimethylchromene is sourced from PubChem (CID 10926955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).