C17H11F3N4O — CID 109270367
2-(2,4-difluoroanilino)-N-(3-fluorophenyl)pyrimidine-5-carboxamide (PubChem CID 109270367) has the molecular formula C17H11F3N4O and a molecular weight of 344.30 g/mol. Its IUPAC name is 2-(2,4-difluoroanilino)-N-(3-fluorophenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(2,4-difluoroanilino)-N-(3-fluorophenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109270367 |
| Molecular Formula | C17H11F3N4O |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-(2,4-difluoroanilino)-N-(3-fluorophenyl)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cnc(Nc2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C17H11F3N4O/c18-11-2-1-3-13(6-11)23-16(25)10-8-21-17(22-9-10)24-15-5-4-12(19)7-14(15)20/h1-9H,(H,23,25)(H,21,22,24) |
| InChIKey | QSBSEMJMFRBNHX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |