C20H21FN4O3 — CID 10927103
butyl 4-(2-fluorophenyl)-7-oxo-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-triene-12-carboxylate (PubChem CID 10927103) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is butyl 4-(2-fluorophenyl)-7-oxo-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-triene-12-carboxylate.
| Compound Name | butyl 4-(2-fluorophenyl)-7-oxo-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-triene-12-carboxylate |
|---|---|
| PubChem CID | 10927103 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | butyl 4-(2-fluorophenyl)-7-oxo-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-triene-12-carboxylate |
| SMILES | CCCCOC(=O)N1CCc2[nH]c(=O)n3cc(-c4ccccc4F)nc3c2C1 |
| InChI | InChI=1S/C20H21FN4O3/c1-2-3-10-28-20(27)24-9-8-16-14(11-24)18-22-17(12-25(18)19(26)23-16)13-6-4-5-7-15(13)21/h4-7,12H,2-3,8-11H2,1H3,(H,23,26) |
| InChIKey | RTHGKLYOGKIOJF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|