C24H32O4 — CID 10927117
(2R,3R)-2-[(2R,5R,7S,8E,10E)-5,7-dihydroxy-11-phenylundeca-8,10-dien-2-yl]-3-ethyl-2,3-dihydropyran-6-one (PubChem CID 10927117) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (2R,3R)-2-[(2R,5R,7S,8E,10E)-5,7-dihydroxy-11-phenylundeca-8,10-dien-2-yl]-3-ethyl-2,3-dihydropyran-6-one.
| Compound Name | (2R,3R)-2-[(2R,5R,7S,8E,10E)-5,7-dihydroxy-11-phenylundeca-8,10-dien-2-yl]-3-ethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 10927117 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (2R,3R)-2-[(2R,5R,7S,8E,10E)-5,7-dihydroxy-11-phenylundeca-8,10-dien-2-yl]-3-ethyl-2,3-dihydropyran-6-one |
| SMILES | CC[C@@H]1C=CC(=O)O[C@@H]1[C@H](C)CC[C@@H](O)C[C@H](O)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H32O4/c1-3-20-14-16-23(27)28-24(20)18(2)13-15-22(26)17-21(25)12-8-7-11-19-9-5-4-6-10-19/h4-12,14,16,18,20-22,24-26H,3,13,15,17H2,1-2H3/b11-7+,12-8+/t18-,20-,21-,22-,24-/m1/s1 |
| InChIKey | IKMNWINZTIFDLH-OLDSPRNQSA-N |
| XLogP | 4.29 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|