C21H25N5O — CID 109272208
[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-[5-(prop-2-enylamino)pyrazin-2-yl]methanone (PubChem CID 109272208) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is [4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-[5-(prop-2-enylamino)pyrazin-2-yl]methanone.
| Compound Name | [4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-[5-(prop-2-enylamino)pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 109272208 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | [4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-[5-(prop-2-enylamino)pyrazin-2-yl]methanone |
| SMILES | C=CCNc1cnc(C(=O)N2CCN(C/C=C/c3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C21H25N5O/c1-2-10-22-20-17-23-19(16-24-20)21(27)26-14-12-25(13-15-26)11-6-9-18-7-4-3-5-8-18/h2-9,16-17H,1,10-15H2,(H,22,24)/b9-6+ |
| InChIKey | IMMQEXGAAVRXAE-RMKNXTFCSA-N |
| XLogP | 2.55 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|