C16H18N4O — CID 109272245
N-ethyl-N-phenyl-5-(prop-2-enylamino)pyrazine-2-carboxamide (PubChem CID 109272245) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-ethyl-N-phenyl-5-(prop-2-enylamino)pyrazine-2-carboxamide.
| Compound Name | N-ethyl-N-phenyl-5-(prop-2-enylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109272245 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-ethyl-N-phenyl-5-(prop-2-enylamino)pyrazine-2-carboxamide |
| SMILES | C=CCNc1cnc(C(=O)N(CC)c2ccccc2)cn1 |
| InChI | InChI=1S/C16H18N4O/c1-3-10-17-15-12-18-14(11-19-15)16(21)20(4-2)13-8-6-5-7-9-13/h3,5-9,11-12H,1,4,10H2,2H3,(H,17,19) |
| InChIKey | JSBNPJCUDUEKKC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|