C21H30N4O — CID 109272506
N-butyl-5-[2,6-di(propan-2-yl)anilino]pyrazine-2-carboxamide (PubChem CID 109272506) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is N-butyl-5-[2,6-di(propan-2-yl)anilino]pyrazine-2-carboxamide.
| Compound Name | N-butyl-5-[2,6-di(propan-2-yl)anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109272506 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | N-butyl-5-[2,6-di(propan-2-yl)anilino]pyrazine-2-carboxamide |
| SMILES | CCCCNC(=O)c1cnc(Nc2c(C(C)C)cccc2C(C)C)cn1 |
| InChI | InChI=1S/C21H30N4O/c1-6-7-11-22-21(26)18-12-24-19(13-23-18)25-20-16(14(2)3)9-8-10-17(20)15(4)5/h8-10,12-15H,6-7,11H2,1-5H3,(H,22,26)(H,24,25) |
| InChIKey | DRHKXJVOAKMVDY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|