C18H24N4O — CID 109272566
N-benzyl-5-(butylamino)-N-ethylpyrazine-2-carboxamide (PubChem CID 109272566) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-benzyl-5-(butylamino)-N-ethylpyrazine-2-carboxamide.
| Compound Name | N-benzyl-5-(butylamino)-N-ethylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109272566 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-benzyl-5-(butylamino)-N-ethylpyrazine-2-carboxamide |
| SMILES | CCCCNc1cnc(C(=O)N(CC)Cc2ccccc2)cn1 |
| InChI | InChI=1S/C18H24N4O/c1-3-5-11-19-17-13-20-16(12-21-17)18(23)22(4-2)14-15-9-7-6-8-10-15/h6-10,12-13H,3-5,11,14H2,1-2H3,(H,19,21) |
| InChIKey | NRGSRFIMWITEGQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|