C15H19N5O — CID 109272569
5-(butylamino)-N-(pyridin-4-ylmethyl)pyrazine-2-carboxamide (PubChem CID 109272569) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 5-(butylamino)-N-(pyridin-4-ylmethyl)pyrazine-2-carboxamide.
| Compound Name | 5-(butylamino)-N-(pyridin-4-ylmethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109272569 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 5-(butylamino)-N-(pyridin-4-ylmethyl)pyrazine-2-carboxamide |
| SMILES | CCCCNc1cnc(C(=O)NCc2ccncc2)cn1 |
| InChI | InChI=1S/C15H19N5O/c1-2-3-6-17-14-11-18-13(10-19-14)15(21)20-9-12-4-7-16-8-5-12/h4-5,7-8,10-11H,2-3,6,9H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | JLZNNWORYJQBSJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|