C23H34O5 — CID 10927267
(5S)-5-[(5R)-5-[(1S,2E)-1-(2-methoxyethoxymethoxy)penta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]-3-methylideneoxolan-2-one (PubChem CID 10927267) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (5S)-5-[(5R)-5-[(1S,2E)-1-(2-methoxyethoxymethoxy)penta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]-3-methylideneoxolan-2-one.
| Compound Name | (5S)-5-[(5R)-5-[(1S,2E)-1-(2-methoxyethoxymethoxy)penta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 10927267 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (5S)-5-[(5R)-5-[(1S,2E)-1-(2-methoxyethoxymethoxy)penta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]-3-methylideneoxolan-2-one |
| SMILES | C=C/C=C/[C@H](OCOCCOC)[C@@H]1CCC(C)=C([C@@H]2CC(=C)C(=O)O2)C1(C)C |
| InChI | InChI=1S/C23H34O5/c1-7-8-9-19(27-15-26-13-12-25-6)18-11-10-16(2)21(23(18,4)5)20-14-17(3)22(24)28-20/h7-9,18-20H,1,3,10-15H2,2,4-6H3/b9-8+/t18-,19-,20-/m0/s1 |
| InChIKey | PQRBAJZAEQNIIB-VGZMHKMPSA-N |
| XLogP | 4.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|