C17H20N4O — CID 109273397
[5-(butan-2-ylamino)pyrazin-2-yl]-(2,3-dihydroindol-1-yl)methanone (PubChem CID 109273397) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is [5-(butan-2-ylamino)pyrazin-2-yl]-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | [5-(butan-2-ylamino)pyrazin-2-yl]-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 109273397 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | [5-(butan-2-ylamino)pyrazin-2-yl]-(2,3-dihydroindol-1-yl)methanone |
| SMILES | CCC(C)Nc1cnc(C(=O)N2CCc3ccccc32)cn1 |
| InChI | InChI=1S/C17H20N4O/c1-3-12(2)20-16-11-18-14(10-19-16)17(22)21-9-8-13-6-4-5-7-15(13)21/h4-7,10-12H,3,8-9H2,1-2H3,(H,19,20) |
| InChIKey | UOLUJNYEAZHHEW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |