C17H19FN4O — CID 109273905
N-cyclopentyl-5-[(2-fluorophenyl)methylamino]pyrazine-2-carboxamide (PubChem CID 109273905) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is N-cyclopentyl-5-[(2-fluorophenyl)methylamino]pyrazine-2-carboxamide.
| Compound Name | N-cyclopentyl-5-[(2-fluorophenyl)methylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109273905 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-cyclopentyl-5-[(2-fluorophenyl)methylamino]pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cnc(NCc2ccccc2F)cn1 |
| InChI | InChI=1S/C17H19FN4O/c18-14-8-4-1-5-12(14)9-20-16-11-19-15(10-21-16)17(23)22-13-6-2-3-7-13/h1,4-5,8,10-11,13H,2-3,6-7,9H2,(H,20,21)(H,22,23) |
| InChIKey | WQUMJBOCDYBXTP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |