C20H38O4Si2 — CID 10927458
(2R,3S,5R,6R)-3-[(1E,3E)-hepta-1,3-dienyl]-2-(hydroxymethyl)-5,6-bis(trimethylsilyloxy)cyclohexan-1-one (PubChem CID 10927458) has the molecular formula C20H38O4Si2 and a molecular weight of 398.69 g/mol. Its IUPAC name is (2R,3S,5R,6R)-3-[(1E,3E)-hepta-1,3-dienyl]-2-(hydroxymethyl)-5,6-bis(trimethylsilyloxy)cyclohexan-1-one.
| Compound Name | (2R,3S,5R,6R)-3-[(1E,3E)-hepta-1,3-dienyl]-2-(hydroxymethyl)-5,6-bis(trimethylsilyloxy)cyclohexan-1-one |
|---|---|
| PubChem CID | 10927458 |
| Molecular Formula | C20H38O4Si2 |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (2R,3S,5R,6R)-3-[(1E,3E)-hepta-1,3-dienyl]-2-(hydroxymethyl)-5,6-bis(trimethylsilyloxy)cyclohexan-1-one |
| SMILES | CCC/C=C/C=C/[C@@H]1C[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)[C@H]1CO |
| InChI | InChI=1S/C20H38O4Si2/c1-8-9-10-11-12-13-16-14-18(23-25(2,3)4)20(24-26(5,6)7)19(22)17(16)15-21/h10-13,16-18,20-21H,8-9,14-15H2,1-7H3/b11-10+,13-12+/t16-,17+,18-,20-/m1/s1 |
| InChIKey | YKIROCVMVCAZJO-KVDKRCFYSA-N |
| XLogP | 4.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|