C16H16Cl2N4O — CID 109274621
N-(2,6-dichlorophenyl)-5-piperidin-1-ylpyrazine-2-carboxamide (PubChem CID 109274621) has the molecular formula C16H16Cl2N4O and a molecular weight of 351.24 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-5-piperidin-1-ylpyrazine-2-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-5-piperidin-1-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109274621 |
| Molecular Formula | C16H16Cl2N4O |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | N-(2,6-dichlorophenyl)-5-piperidin-1-ylpyrazine-2-carboxamide |
| SMILES | O=C(Nc1c(Cl)cccc1Cl)c1cnc(N2CCCCC2)cn1 |
| InChI | InChI=1S/C16H16Cl2N4O/c17-11-5-4-6-12(18)15(11)21-16(23)13-9-20-14(10-19-13)22-7-2-1-3-8-22/h4-6,9-10H,1-3,7-8H2,(H,21,23) |
| InChIKey | VEPBVSOBVLDORD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |