C21H40O5Si — CID 10927500
2-[(4S,6S)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl acetate (PubChem CID 10927500) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is 2-[(4S,6S)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl acetate.
| Compound Name | 2-[(4S,6S)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl acetate |
|---|---|
| PubChem CID | 10927500 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2-[(4S,6S)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl acetate |
| SMILES | C=CC[C@H](C[C@@H]1C[C@H](CCOC(C)=O)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O5Si/c1-10-11-18(26-27(8,9)20(3,4)5)15-19-14-17(12-13-23-16(2)22)24-21(6,7)25-19/h10,17-19H,1,11-15H2,2-9H3/t17-,18+,19-/m0/s1 |
| InChIKey | GJYYSUPRCSSVJF-OTWHNJEPSA-N |
| XLogP | 5.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|