C18H21ClN4O2 — CID 109275297
N-(3-chloro-4-methoxyphenyl)-5-(4-methylpiperidin-1-yl)pyrazine-2-carboxamide (PubChem CID 109275297) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-5-(4-methylpiperidin-1-yl)pyrazine-2-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-5-(4-methylpiperidin-1-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109275297 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-5-(4-methylpiperidin-1-yl)pyrazine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cnc(N3CCC(C)CC3)cn2)cc1Cl |
| InChI | InChI=1S/C18H21ClN4O2/c1-12-5-7-23(8-6-12)17-11-20-15(10-21-17)18(24)22-13-3-4-16(25-2)14(19)9-13/h3-4,9-12H,5-8H2,1-2H3,(H,22,24) |
| InChIKey | WWCHMDXKCBNWSD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |