C23H29N5O — CID 109275408
N-[2-(cyclohexen-1-yl)ethyl]-5-(4-phenylpiperazin-1-yl)pyrazine-2-carboxamide (PubChem CID 109275408) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-(4-phenylpiperazin-1-yl)pyrazine-2-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-(4-phenylpiperazin-1-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109275408 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-(4-phenylpiperazin-1-yl)pyrazine-2-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cnc(N2CCN(c3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C23H29N5O/c29-23(24-12-11-19-7-3-1-4-8-19)21-17-26-22(18-25-21)28-15-13-27(14-16-28)20-9-5-2-6-10-20/h2,5-7,9-10,17-18H,1,3-4,8,11-16H2,(H,24,29) |
| InChIKey | AXIYVGWSEXLTHQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|