C17H22N4O4 — CID 109276326
N-(3,4-dimethoxyphenyl)-5-(3-methoxypropylamino)pyrazine-2-carboxamide (PubChem CID 109276326) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-5-(3-methoxypropylamino)pyrazine-2-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-5-(3-methoxypropylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109276326 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-5-(3-methoxypropylamino)pyrazine-2-carboxamide |
| SMILES | COCCCNc1cnc(C(=O)Nc2ccc(OC)c(OC)c2)cn1 |
| InChI | InChI=1S/C17H22N4O4/c1-23-8-4-7-18-16-11-19-13(10-20-16)17(22)21-12-5-6-14(24-2)15(9-12)25-3/h5-6,9-11H,4,7-8H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | RGWLYQOXSRPLLS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|