C24H42O3Si — CID 10927646
(1S,2R,3R,5S,6R,7S,8R)-3-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-ol (PubChem CID 10927646) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is (1S,2R,3R,5S,6R,7S,8R)-3-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-ol.
| Compound Name | (1S,2R,3R,5S,6R,7S,8R)-3-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-ol |
|---|---|
| PubChem CID | 10927646 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (1S,2R,3R,5S,6R,7S,8R)-3-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCCC[C@]12O[C@H]1[C@H](O)[C@@H]1[C@H]2[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C24H42O3Si/c1-23(2,3)28(4,5)26-15-11-9-7-6-8-10-14-24-20-18-13-12-17(16-18)19(20)21(25)22(24)27-24/h12-13,17-22,25H,6-11,14-16H2,1-5H3/t17-,18+,19-,20+,21+,22-,24+/m0/s1 |
| InChIKey | FOTXTALGWFCKIU-HMBAJOOYSA-N |
| XLogP | 5.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|