C22H22BClN2O3 — CID 10927692
5-chloro-1-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl]-2-phenylimidazole-4-carbaldehyde (PubChem CID 10927692) has the molecular formula C22H22BClN2O3 and a molecular weight of 408.69 g/mol. Its IUPAC name is 5-chloro-1-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl]-2-phenylimidazole-4-carbaldehyde.
| Compound Name | 5-chloro-1-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl]-2-phenylimidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 10927692 |
| Molecular Formula | C22H22BClN2O3 |
| Molecular Weight | 408.69 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 5-chloro-1-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl]-2-phenylimidazole-4-carbaldehyde |
| SMILES | CC1(C)COB(c2ccc(Cn3c(-c4ccccc4)nc(C=O)c3Cl)cc2)OC1 |
| InChI | InChI=1S/C22H22BClN2O3/c1-22(2)14-28-23(29-15-22)18-10-8-16(9-11-18)12-26-20(24)19(13-27)25-21(26)17-6-4-3-5-7-17/h3-11,13H,12,14-15H2,1-2H3 |
| InChIKey | DEAIMAMIUZDVBG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|