C15H23N5O2 — CID 109276926
(4-methylpiperazin-1-yl)-[5-(oxolan-2-ylmethylamino)pyrazin-2-yl]methanone (PubChem CID 109276926) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[5-(oxolan-2-ylmethylamino)pyrazin-2-yl]methanone.
| Compound Name | (4-methylpiperazin-1-yl)-[5-(oxolan-2-ylmethylamino)pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 109276926 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[5-(oxolan-2-ylmethylamino)pyrazin-2-yl]methanone |
| SMILES | CN1CCN(C(=O)c2cnc(NCC3CCCO3)cn2)CC1 |
| InChI | InChI=1S/C15H23N5O2/c1-19-4-6-20(7-5-19)15(21)13-10-18-14(11-16-13)17-9-12-3-2-8-22-12/h10-12H,2-9H2,1H3,(H,17,18) |
| InChIKey | NDRMPOODHPJJGS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |