C14H23N5O — CID 109278299
N-tert-butyl-5-(4-methylpiperazin-1-yl)pyrazine-2-carboxamide (PubChem CID 109278299) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is N-tert-butyl-5-(4-methylpiperazin-1-yl)pyrazine-2-carboxamide.
| Compound Name | N-tert-butyl-5-(4-methylpiperazin-1-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109278299 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | N-tert-butyl-5-(4-methylpiperazin-1-yl)pyrazine-2-carboxamide |
| SMILES | CN1CCN(c2cnc(C(=O)NC(C)(C)C)cn2)CC1 |
| InChI | InChI=1S/C14H23N5O/c1-14(2,3)17-13(20)11-9-16-12(10-15-11)19-7-5-18(4)6-8-19/h9-10H,5-8H2,1-4H3,(H,17,20) |
| InChIKey | RGANHAPNCPJYHE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |