C15H17N5O3 — CID 109278877
5-(4-formylpiperazin-1-yl)-N-(furan-2-ylmethyl)pyrazine-2-carboxamide (PubChem CID 109278877) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is 5-(4-formylpiperazin-1-yl)-N-(furan-2-ylmethyl)pyrazine-2-carboxamide.
| Compound Name | 5-(4-formylpiperazin-1-yl)-N-(furan-2-ylmethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109278877 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 5-(4-formylpiperazin-1-yl)-N-(furan-2-ylmethyl)pyrazine-2-carboxamide |
| SMILES | O=CN1CCN(c2cnc(C(=O)NCc3ccco3)cn2)CC1 |
| InChI | InChI=1S/C15H17N5O3/c21-11-19-3-5-20(6-4-19)14-10-16-13(9-17-14)15(22)18-8-12-2-1-7-23-12/h1-2,7,9-11H,3-6,8H2,(H,18,22) |
| InChIKey | XDNZYMZLOZIKEF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|