About (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one
(2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one (PubChem CID 10927967) has the molecular formula C16H27IO3Si
and a molecular weight of 422.38 g/mol. Its IUPAC name is (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one.
Molecular Properties
| Compound Name | (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one |
| PubChem CID | 10927967 |
| Molecular Formula | C16H27IO3Si |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one |
| SMILES | C[C@H]1C=C(CC[C@H](/C=C/I)O[Si](C)(C)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C16H27IO3Si/c1-12-11-13(15(18)19-12)7-8-14(9-10-17)20-21(5,6)16(2,3)4/h9-12,14H,7-8H2,1-6H3/b10-9+/t12-,14+/m0/s1 |
| InChIKey | SFDTUFODVUXNIW-JMRXXTBOSA-N |
| XLogP | 4.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one?
The IUPAC name of (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one (CID 10927967) is (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one.
What is the SMILES notation for (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one?
The canonical SMILES for (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one is C[C@H]1C=C(CC[C@H](/C=C/I)O[Si](C)(C)C(C)(C)C)C(=O)O1.
What is the InChIKey of (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one?
The InChIKey is SFDTUFODVUXNIW-JMRXXTBOSA-N. The full InChI is InChI=1S/C16H27IO3Si/c1-12-11-13(15(18)19-12)7-8-14(9-10-17)20-21(5,6)16(2,3)4/h9-12,14H,7-8H2,1-6H3/b10-9+/t12-,14+/m0/s1.
What are the key properties of (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one?
(2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one has a molecular weight of 422.38 g/mol, XLogP of 4.98, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-2-methyl-2H-furan-5-one is sourced from PubChem (CID 10927967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).