C19H15F3N4O — CID 109279902
5-(benzylamino)-N-[2-(trifluoromethyl)phenyl]pyrazine-2-carboxamide (PubChem CID 109279902) has the molecular formula C19H15F3N4O and a molecular weight of 372.35 g/mol. Its IUPAC name is 5-(benzylamino)-N-[2-(trifluoromethyl)phenyl]pyrazine-2-carboxamide.
| Compound Name | 5-(benzylamino)-N-[2-(trifluoromethyl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109279902 |
| Molecular Formula | C19H15F3N4O |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 5-(benzylamino)-N-[2-(trifluoromethyl)phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)c1cnc(NCc2ccccc2)cn1 |
| InChI | InChI=1S/C19H15F3N4O/c20-19(21,22)14-8-4-5-9-15(14)26-18(27)16-11-25-17(12-23-16)24-10-13-6-2-1-3-7-13/h1-9,11-12H,10H2,(H,24,25)(H,26,27) |
| InChIKey | NCSSDOYZVMFQQV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |