C26H33NO4 — CID 10928002
(4R)-3-[(2R,3R)-2-[(R)-hydroxy(phenyl)methyl]-3-methylnonanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 10928002) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is (4R)-3-[(2R,3R)-2-[(R)-hydroxy(phenyl)methyl]-3-methylnonanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2R,3R)-2-[(R)-hydroxy(phenyl)methyl]-3-methylnonanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10928002 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (4R)-3-[(2R,3R)-2-[(R)-hydroxy(phenyl)methyl]-3-methylnonanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCC[C@@H](C)[C@@H](C(=O)N1C(=O)OC[C@H]1c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C26H33NO4/c1-3-4-5-8-13-19(2)23(24(28)21-16-11-7-12-17-21)25(29)27-22(18-31-26(27)30)20-14-9-6-10-15-20/h6-7,9-12,14-17,19,22-24,28H,3-5,8,13,18H2,1-2H3/t19-,22+,23-,24+/m1/s1 |
| InChIKey | SUUIAINZNYHJEQ-GOUWZUTHSA-N |
| XLogP | 5.66 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|