C27H43N3O — CID 10928037
2-[(3aS,6aR)-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl]ethanol (PubChem CID 10928037) has the molecular formula C27H43N3O and a molecular weight of 425.66 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl]ethanol.
| Compound Name | 2-[(3aS,6aR)-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl]ethanol |
|---|---|
| PubChem CID | 10928037 |
| Molecular Formula | C27H43N3O |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.34 |
| IUPAC Name | 2-[(3aS,6aR)-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl]ethanol |
| SMILES | CC(C)C1CCC(N2CCC3(CC2)[C@@H]2CN(CCO)C[C@@H]2CN3c2ccccc2)CC1 |
| InChI | InChI=1S/C27H43N3O/c1-21(2)22-8-10-24(11-9-22)29-14-12-27(13-15-29)26-20-28(16-17-31)18-23(26)19-30(27)25-6-4-3-5-7-25/h3-7,21-24,26,31H,8-20H2,1-2H3/t22?,23-,24?,26-/m1/s1 |
| InChIKey | PHEREHWNPUIWHS-QLKMXJDUSA-N |
| XLogP | 4.10 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |