C7H2F14O3S — CID 10928174
2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl trifluoromethanesulfonate (PubChem CID 10928174) has the molecular formula C7H2F14O3S and a molecular weight of 432.13 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl trifluoromethanesulfonate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10928174 |
| Molecular Formula | C7H2F14O3S |
| Molecular Weight | 432.13 g/mol |
| Exact Mass | 431.95 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H2F14O3S/c8-2(9,1-24-25(22,23)7(19,20)21)3(10,11)4(12,13)5(14,15)6(16,17)18/h1H2 |
| InChIKey | OJCJXJDRDHYJSH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.13 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|