C20H17ClN4O2 — CID 109282153
N-(3-acetylphenyl)-5-[(4-chlorophenyl)methylamino]pyrazine-2-carboxamide (PubChem CID 109282153) has the molecular formula C20H17ClN4O2 and a molecular weight of 380.84 g/mol. Its IUPAC name is N-(3-acetylphenyl)-5-[(4-chlorophenyl)methylamino]pyrazine-2-carboxamide.
| Compound Name | N-(3-acetylphenyl)-5-[(4-chlorophenyl)methylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109282153 |
| Molecular Formula | C20H17ClN4O2 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-(3-acetylphenyl)-5-[(4-chlorophenyl)methylamino]pyrazine-2-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2cnc(NCc3ccc(Cl)cc3)cn2)c1 |
| InChI | InChI=1S/C20H17ClN4O2/c1-13(26)15-3-2-4-17(9-15)25-20(27)18-11-24-19(12-22-18)23-10-14-5-7-16(21)8-6-14/h2-9,11-12H,10H2,1H3,(H,23,24)(H,25,27) |
| InChIKey | XYDZWVANAPVBRJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |