C19H16F2N4O2 — CID 109282276
5-(3,4-difluoroanilino)-N-[(2-methoxyphenyl)methyl]pyrazine-2-carboxamide (PubChem CID 109282276) has the molecular formula C19H16F2N4O2 and a molecular weight of 370.36 g/mol. Its IUPAC name is 5-(3,4-difluoroanilino)-N-[(2-methoxyphenyl)methyl]pyrazine-2-carboxamide.
| Compound Name | 5-(3,4-difluoroanilino)-N-[(2-methoxyphenyl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109282276 |
| Molecular Formula | C19H16F2N4O2 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 5-(3,4-difluoroanilino)-N-[(2-methoxyphenyl)methyl]pyrazine-2-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1cnc(Nc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C19H16F2N4O2/c1-27-17-5-3-2-4-12(17)9-24-19(26)16-10-23-18(11-22-16)25-13-6-7-14(20)15(21)8-13/h2-8,10-11H,9H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | KMVNZXVYKATXGQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |