C24H28N4O — CID 109282875
5-[benzyl(ethyl)amino]-N-(2-tert-butylphenyl)pyrazine-2-carboxamide (PubChem CID 109282875) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 5-[benzyl(ethyl)amino]-N-(2-tert-butylphenyl)pyrazine-2-carboxamide.
| Compound Name | 5-[benzyl(ethyl)amino]-N-(2-tert-butylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109282875 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 5-[benzyl(ethyl)amino]-N-(2-tert-butylphenyl)pyrazine-2-carboxamide |
| SMILES | CCN(Cc1ccccc1)c1cnc(C(=O)Nc2ccccc2C(C)(C)C)cn1 |
| InChI | InChI=1S/C24H28N4O/c1-5-28(17-18-11-7-6-8-12-18)22-16-25-21(15-26-22)23(29)27-20-14-10-9-13-19(20)24(2,3)4/h6-16H,5,17H2,1-4H3,(H,27,29) |
| InChIKey | ZJRNYADFLCCCAI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |