C23H35BrO2Si — CID 10928486
[(2S,4aS)-8-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,9,10-tetrahydro-2H-phenanthren-2-yl]oxy-(bromomethyl)-dimethylsilane (PubChem CID 10928486) has the molecular formula C23H35BrO2Si and a molecular weight of 451.52 g/mol. Its IUPAC name is [(2S,4aS)-8-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,9,10-tetrahydro-2H-phenanthren-2-yl]oxy-(bromomethyl)-dimethylsilane.
| Compound Name | [(2S,4aS)-8-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,9,10-tetrahydro-2H-phenanthren-2-yl]oxy-(bromomethyl)-dimethylsilane |
|---|---|
| PubChem CID | 10928486 |
| Molecular Formula | C23H35BrO2Si |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [(2S,4aS)-8-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,9,10-tetrahydro-2H-phenanthren-2-yl]oxy-(bromomethyl)-dimethylsilane |
| SMILES | COc1c(C(C)C)ccc2c1CCC1=C(C)[C@@H](O[Si](C)(C)CBr)CC[C@@]12C |
| InChI | InChI=1S/C23H35BrO2Si/c1-15(2)17-8-11-20-18(22(17)25-5)9-10-19-16(3)21(12-13-23(19,20)4)26-27(6,7)14-24/h8,11,15,21H,9-10,12-14H2,1-7H3/t21-,23-/m0/s1 |
| InChIKey | PJXKNTZHOKWGIV-GMAHTHKFSA-N |
| XLogP | 6.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|