C23H18FN3O2S2 — CID 10928487
5-(4-fluorophenyl)-2-[(4-methylsulfonylphenyl)methylsulfanyl]-4-pyridin-3-ylpyrimidine (PubChem CID 10928487) has the molecular formula C23H18FN3O2S2 and a molecular weight of 451.55 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-[(4-methylsulfonylphenyl)methylsulfanyl]-4-pyridin-3-ylpyrimidine.
| Compound Name | 5-(4-fluorophenyl)-2-[(4-methylsulfonylphenyl)methylsulfanyl]-4-pyridin-3-ylpyrimidine |
|---|---|
| PubChem CID | 10928487 |
| Molecular Formula | C23H18FN3O2S2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 5-(4-fluorophenyl)-2-[(4-methylsulfonylphenyl)methylsulfanyl]-4-pyridin-3-ylpyrimidine |
| SMILES | CS(=O)(=O)c1ccc(CSc2ncc(-c3ccc(F)cc3)c(-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C23H18FN3O2S2/c1-31(28,29)20-10-4-16(5-11-20)15-30-23-26-14-21(17-6-8-19(24)9-7-17)22(27-23)18-3-2-12-25-13-18/h2-14H,15H2,1H3 |
| InChIKey | XBCXWDKYEKSDLP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |