C17H19N5O4S — CID 109285306
N-(4-acetamidophenyl)-5-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxamide (PubChem CID 109285306) has the molecular formula C17H19N5O4S and a molecular weight of 389.44 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-5-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-5-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109285306 |
| Molecular Formula | C17H19N5O4S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-(4-acetamidophenyl)-5-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cnc(NC3CCS(=O)(=O)C3)cn2)cc1 |
| InChI | InChI=1S/C17H19N5O4S/c1-11(23)20-12-2-4-13(5-3-12)22-17(24)15-8-19-16(9-18-15)21-14-6-7-27(25,26)10-14/h2-5,8-9,14H,6-7,10H2,1H3,(H,19,21)(H,20,23)(H,22,24) |
| InChIKey | YQTXASCJOQYYAT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |