C16H18N4O3S — CID 109285400
5-[(1,1-dioxothiolan-3-yl)-methylamino]-N-phenylpyrazine-2-carboxamide (PubChem CID 109285400) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 5-[(1,1-dioxothiolan-3-yl)-methylamino]-N-phenylpyrazine-2-carboxamide.
| Compound Name | 5-[(1,1-dioxothiolan-3-yl)-methylamino]-N-phenylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109285400 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 5-[(1,1-dioxothiolan-3-yl)-methylamino]-N-phenylpyrazine-2-carboxamide |
| SMILES | CN(c1cnc(C(=O)Nc2ccccc2)cn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H18N4O3S/c1-20(13-7-8-24(22,23)11-13)15-10-17-14(9-18-15)16(21)19-12-5-3-2-4-6-12/h2-6,9-10,13H,7-8,11H2,1H3,(H,19,21) |
| InChIKey | CDBDEOYIIYRWGK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |