C27H38O4Si — CID 10928542
methyl (E,5R,6S,7S)-8-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-5,7-dimethyloct-3-enoate (PubChem CID 10928542) has the molecular formula C27H38O4Si and a molecular weight of 454.68 g/mol. Its IUPAC name is methyl (E,5R,6S,7S)-8-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-5,7-dimethyloct-3-enoate.
| Compound Name | methyl (E,5R,6S,7S)-8-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-5,7-dimethyloct-3-enoate |
|---|---|
| PubChem CID | 10928542 |
| Molecular Formula | C27H38O4Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | methyl (E,5R,6S,7S)-8-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-5,7-dimethyloct-3-enoate |
| SMILES | COC(=O)C/C=C/[C@@H](C)[C@H](O)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H38O4Si/c1-21(14-13-19-25(28)30-6)26(29)22(2)20-31-32(27(3,4)5,23-15-9-7-10-16-23)24-17-11-8-12-18-24/h7-18,21-22,26,29H,19-20H2,1-6H3/b14-13+/t21-,22+,26+/m1/s1 |
| InChIKey | VOTRFNUSKYIEJV-ZSUJDQAISA-N |
| XLogP | 4.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|