C27H31N5O2 — CID 10928587
6-[4-(4-benzhydryloxypiperidin-1-yl)butoxy]-[1,2,4]triazolo[1,5-b]pyridazine (PubChem CID 10928587) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 6-[4-(4-benzhydryloxypiperidin-1-yl)butoxy]-[1,2,4]triazolo[1,5-b]pyridazine.
| Compound Name | 6-[4-(4-benzhydryloxypiperidin-1-yl)butoxy]-[1,2,4]triazolo[1,5-b]pyridazine |
|---|---|
| PubChem CID | 10928587 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 6-[4-(4-benzhydryloxypiperidin-1-yl)butoxy]-[1,2,4]triazolo[1,5-b]pyridazine |
| SMILES | c1ccc(C(OC2CCN(CCCCOc3ccc4ncnn4n3)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H31N5O2/c1-3-9-22(10-4-1)27(23-11-5-2-6-12-23)34-24-15-18-31(19-16-24)17-7-8-20-33-26-14-13-25-28-21-29-32(25)30-26/h1-6,9-14,21,24,27H,7-8,15-20H2 |
| InChIKey | GPZZULYUWWJDEC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|