C28H46O3Si — CID 10928617
ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 10928617) has the molecular formula C28H46O3Si and a molecular weight of 458.76 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 10928617 |
| Molecular Formula | C28H46O3Si |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(O[Si](CC)(CC)CC)CCC1(C)C |
| InChI | InChI=1S/C28H46O3Si/c1-10-30-27(29)21-23(6)16-14-15-22(5)17-18-25-24(7)26(19-20-28(25,8)9)31-32(11-2,12-3)13-4/h14-18,21,26H,10-13,19-20H2,1-9H3/b16-14+,18-17+,22-15+,23-21+ |
| InChIKey | GRLAIXJZUYFTDS-FEIVCLRPSA-N |
| XLogP | 8.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|