C21H26N4O — CID 109287476
N-cycloheptyl-5-(3,4-dihydro-2H-quinolin-1-yl)pyrazine-2-carboxamide (PubChem CID 109287476) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is N-cycloheptyl-5-(3,4-dihydro-2H-quinolin-1-yl)pyrazine-2-carboxamide.
| Compound Name | N-cycloheptyl-5-(3,4-dihydro-2H-quinolin-1-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109287476 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-cycloheptyl-5-(3,4-dihydro-2H-quinolin-1-yl)pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCCCCC1)c1cnc(N2CCCc3ccccc32)cn1 |
| InChI | InChI=1S/C21H26N4O/c26-21(24-17-10-3-1-2-4-11-17)18-14-23-20(15-22-18)25-13-7-9-16-8-5-6-12-19(16)25/h5-6,8,12,14-15,17H,1-4,7,9-11,13H2,(H,24,26) |
| InChIKey | WINBWHQTPGUCPI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |