C18H22Cl2N4O — CID 109288120
N-[2-(2,4-dichlorophenyl)ethyl]-5-(pentylamino)pyrazine-2-carboxamide (PubChem CID 109288120) has the molecular formula C18H22Cl2N4O and a molecular weight of 381.31 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-5-(pentylamino)pyrazine-2-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-5-(pentylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109288120 |
| Molecular Formula | C18H22Cl2N4O |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-5-(pentylamino)pyrazine-2-carboxamide |
| SMILES | CCCCCNc1cnc(C(=O)NCCc2ccc(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C18H22Cl2N4O/c1-2-3-4-8-21-17-12-23-16(11-24-17)18(25)22-9-7-13-5-6-14(19)10-15(13)20/h5-6,10-12H,2-4,7-9H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | GSVPWMQWPFIQPT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|