C16H18Cl2N4O — CID 109288331
N-butyl-5-(2,3-dichloroanilino)-N-methylpyrazine-2-carboxamide (PubChem CID 109288331) has the molecular formula C16H18Cl2N4O and a molecular weight of 353.25 g/mol. Its IUPAC name is N-butyl-5-(2,3-dichloroanilino)-N-methylpyrazine-2-carboxamide.
| Compound Name | N-butyl-5-(2,3-dichloroanilino)-N-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109288331 |
| Molecular Formula | C16H18Cl2N4O |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-butyl-5-(2,3-dichloroanilino)-N-methylpyrazine-2-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cnc(Nc2cccc(Cl)c2Cl)cn1 |
| InChI | InChI=1S/C16H18Cl2N4O/c1-3-4-8-22(2)16(23)13-9-20-14(10-19-13)21-12-7-5-6-11(17)15(12)18/h5-7,9-10H,3-4,8H2,1-2H3,(H,20,21) |
| InChIKey | WNHZKPNBACQQMD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |