C18H20F2N4O — CID 109288660
N-(2,4-difluorophenyl)-5-(2-ethylpiperidin-1-yl)pyrazine-2-carboxamide (PubChem CID 109288660) has the molecular formula C18H20F2N4O and a molecular weight of 346.38 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-(2-ethylpiperidin-1-yl)pyrazine-2-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-5-(2-ethylpiperidin-1-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109288660 |
| Molecular Formula | C18H20F2N4O |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-(2-ethylpiperidin-1-yl)pyrazine-2-carboxamide |
| SMILES | CCC1CCCCN1c1cnc(C(=O)Nc2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C18H20F2N4O/c1-2-13-5-3-4-8-24(13)17-11-21-16(10-22-17)18(25)23-15-7-6-12(19)9-14(15)20/h6-7,9-11,13H,2-5,8H2,1H3,(H,23,25) |
| InChIKey | VZBFHWGPNMRRDE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |