C18H21BrN4O — CID 109288760
[5-(4-bromo-2-methylanilino)pyrazin-2-yl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 109288760) has the molecular formula C18H21BrN4O and a molecular weight of 389.30 g/mol. Its IUPAC name is [5-(4-bromo-2-methylanilino)pyrazin-2-yl]-(3-methylpiperidin-1-yl)methanone.
| Compound Name | [5-(4-bromo-2-methylanilino)pyrazin-2-yl]-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109288760 |
| Molecular Formula | C18H21BrN4O |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [5-(4-bromo-2-methylanilino)pyrazin-2-yl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | Cc1cc(Br)ccc1Nc1cnc(C(=O)N2CCCC(C)C2)cn1 |
| InChI | InChI=1S/C18H21BrN4O/c1-12-4-3-7-23(11-12)18(24)16-9-21-17(10-20-16)22-15-6-5-14(19)8-13(15)2/h5-6,8-10,12H,3-4,7,11H2,1-2H3,(H,21,22) |
| InChIKey | FIRLGORXTQQOHL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |