C19H26N4O — CID 109288920
5-(N-ethylanilino)-N,N-dipropylpyrazine-2-carboxamide (PubChem CID 109288920) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 5-(N-ethylanilino)-N,N-dipropylpyrazine-2-carboxamide.
| Compound Name | 5-(N-ethylanilino)-N,N-dipropylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109288920 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 5-(N-ethylanilino)-N,N-dipropylpyrazine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cnc(N(CC)c2ccccc2)cn1 |
| InChI | InChI=1S/C19H26N4O/c1-4-12-22(13-5-2)19(24)17-14-21-18(15-20-17)23(6-3)16-10-8-7-9-11-16/h7-11,14-15H,4-6,12-13H2,1-3H3 |
| InChIKey | XBISXMULXMPCEG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |