C21H29N5O — CID 109288967
N,N-dipropyl-5-(4-pyrrolidin-1-ylanilino)pyrazine-2-carboxamide (PubChem CID 109288967) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is N,N-dipropyl-5-(4-pyrrolidin-1-ylanilino)pyrazine-2-carboxamide.
| Compound Name | N,N-dipropyl-5-(4-pyrrolidin-1-ylanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109288967 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | N,N-dipropyl-5-(4-pyrrolidin-1-ylanilino)pyrazine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cnc(Nc2ccc(N3CCCC3)cc2)cn1 |
| InChI | InChI=1S/C21H29N5O/c1-3-11-26(12-4-2)21(27)19-15-23-20(16-22-19)24-17-7-9-18(10-8-17)25-13-5-6-14-25/h7-10,15-16H,3-6,11-14H2,1-2H3,(H,23,24) |
| InChIKey | SIDWQAXFXOPEAI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|