C20H22N6O3 — CID 109289419
5-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)pyrazine-2-carboxamide (PubChem CID 109289419) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is 5-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)pyrazine-2-carboxamide.
| Compound Name | 5-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109289419 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 5-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)pyrazine-2-carboxamide |
| SMILES | COc1ccc(N2CCN(c3cnc(C(=O)Nc4cc(C)on4)cn3)CC2)cc1 |
| InChI | InChI=1S/C20H22N6O3/c1-14-11-18(24-29-14)23-20(27)17-12-22-19(13-21-17)26-9-7-25(8-10-26)15-3-5-16(28-2)6-4-15/h3-6,11-13H,7-10H2,1-2H3,(H,23,24,27) |
| InChIKey | LWHOMGIJQGZBDR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|